C11H14ClNO2 — CID 786712
3-chloro-N-[(2R)-1-hydroxybutan-2-yl]benzamide (PubChem CID 786712) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]benzamide.
| Compound Name | 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]benzamide |
|---|---|
| PubChem CID | 786712 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]benzamide |
| SMILES | CC[C@H](CO)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO2/c1-2-10(7-14)13-11(15)8-4-3-5-9(12)6-8/h3-6,10,14H,2,7H2,1H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | SCIXBNDJXZMNSE-SNVBAGLBSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |