C17H23N3O2 — CID 78672212
N-heptan-2-yl-2-(4-oxocinnolin-1-yl)acetamide (PubChem CID 78672212) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-heptan-2-yl-2-(4-oxocinnolin-1-yl)acetamide.
| Compound Name | N-heptan-2-yl-2-(4-oxocinnolin-1-yl)acetamide |
|---|---|
| PubChem CID | 78672212 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-heptan-2-yl-2-(4-oxocinnolin-1-yl)acetamide |
| SMILES | CCCCCC(C)NC(=O)Cn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O2/c1-3-4-5-8-13(2)19-17(22)12-20-15-10-7-6-9-14(15)16(21)11-18-20/h6-7,9-11,13H,3-5,8,12H2,1-2H3,(H,19,22) |
| InChIKey | HJYYNCLNMFCEFI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|