C16H21N3O3 — CID 7867252
2-(2-acetamidophenoxy)-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide (PubChem CID 7867252) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(2-acetamidophenoxy)-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide.
| Compound Name | 2-(2-acetamidophenoxy)-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7867252 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-(2-acetamidophenoxy)-N-[(2S)-2-cyano-3-methylbutan-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccccc1OCC(=O)N[C@](C)(C#N)C(C)C |
| InChI | InChI=1S/C16H21N3O3/c1-11(2)16(4,10-17)19-15(21)9-22-14-8-6-5-7-13(14)18-12(3)20/h5-8,11H,9H2,1-4H3,(H,18,20)(H,19,21)/t16-/m1/s1 |
| InChIKey | SDNLJVRLPMZYEO-MRXNPFEDSA-N |
| XLogP | 2.08 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |