C17H15ClN2O5 — CID 7867579
[(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate (PubChem CID 7867579) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate.
| Compound Name | [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 7867579 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [(2R)-1-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-1-oxopropan-2-yl] 2-chloropyridine-3-carboxylate |
| SMILES | C[C@@H](OC(=O)c1cccnc1Cl)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H15ClN2O5/c1-10(25-17(22)12-3-2-6-19-15(12)18)16(21)20-11-4-5-13-14(9-11)24-8-7-23-13/h2-6,9-10H,7-8H2,1H3,(H,20,21)/t10-/m1/s1 |
| InChIKey | MVEGLCGIFQUVGW-SNVBAGLBSA-N |
| XLogP | 2.69 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|