About [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate (PubChem CID 7867723) has the molecular formula C16H10ClFN2O2S
and a molecular weight of 348.79 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate |
| PubChem CID | 7867723 |
| Molecular Formula | C16H10ClFN2O2S |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccc(F)cc2)n1)c1cccnc1Cl |
| InChI | InChI=1S/C16H10ClFN2O2S/c17-14-13(2-1-7-19-14)16(21)22-8-12-9-23-15(20-12)10-3-5-11(18)6-4-10/h1-7,9H,8H2 |
| InChIKey | HLXHCPXRTSCXDX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate?
The IUPAC name of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate (CID 7867723) is [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate.
What is the SMILES notation for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate?
The canonical SMILES for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate is O=C(OCc1csc(-c2ccc(F)cc2)n1)c1cccnc1Cl.
What is the InChIKey of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate?
The InChIKey is HLXHCPXRTSCXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClFN2O2S/c17-14-13(2-1-7-19-14)16(21)22-8-12-9-23-15(20-12)10-3-5-11(18)6-4-10/h1-7,9H,8H2.
What are the key properties of [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate?
[2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate has a molecular weight of 348.79 g/mol, XLogP of 4.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-1,3-thiazol-4-yl]methyl 2-chloropyridine-3-carboxylate is sourced from PubChem (CID 7867723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).