About 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid
2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (PubChem CID 786782) has the molecular formula C13H8N2O4
and a molecular weight of 256.22 g/mol. Its IUPAC name is 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| PubChem CID | 786782 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| SMILES | NN1C(=O)c2cccc3c(C(=O)O)ccc(c23)C1=O |
| InChI | InChI=1S/C13H8N2O4/c14-15-11(16)8-3-1-2-6-7(13(18)19)4-5-9(10(6)8)12(15)17/h1-5H,14H2,(H,18,19) |
| InChIKey | UQEVRZOHAWNWFM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The IUPAC name of 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (CID 786782) is 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid.
What is the SMILES notation for 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The canonical SMILES for 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid is NN1C(=O)c2cccc3c(C(=O)O)ccc(c23)C1=O.
What is the InChIKey of 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
The InChIKey is UQEVRZOHAWNWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O4/c14-15-11(16)8-3-1-2-6-7(13(18)19)4-5-9(10(6)8)12(15)17/h1-5H,14H2,(H,18,19).
What are the key properties of 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid?
2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid has a molecular weight of 256.22 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid is sourced from PubChem (CID 786782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).