About 2-sulfanylidene-1,3-benzothiazin-4-one
2-sulfanylidene-1,3-benzothiazin-4-one (PubChem CID 786880) has the molecular formula C8H5NOS2
and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-sulfanylidene-1,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-sulfanylidene-1,3-benzothiazin-4-one |
| PubChem CID | 786880 |
| Molecular Formula | C8H5NOS2 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 194.98 |
| IUPAC Name | 2-sulfanylidene-1,3-benzothiazin-4-one |
| SMILES | O=c1[nH]c(=S)sc2ccccc12 |
| InChI | InChI=1S/C8H5NOS2/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h1-4H,(H,9,10,11) |
| InChIKey | OLKPPPPATKQSBL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-1,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-1,3-benzothiazin-4-one?
The IUPAC name of 2-sulfanylidene-1,3-benzothiazin-4-one (CID 786880) is 2-sulfanylidene-1,3-benzothiazin-4-one.
What is the SMILES notation for 2-sulfanylidene-1,3-benzothiazin-4-one?
The canonical SMILES for 2-sulfanylidene-1,3-benzothiazin-4-one is O=c1[nH]c(=S)sc2ccccc12.
What is the InChIKey of 2-sulfanylidene-1,3-benzothiazin-4-one?
The InChIKey is OLKPPPPATKQSBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NOS2/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h1-4H,(H,9,10,11).
What are the key properties of 2-sulfanylidene-1,3-benzothiazin-4-one?
2-sulfanylidene-1,3-benzothiazin-4-one has a molecular weight of 195.27 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-1,3-benzothiazin-4-one is sourced from PubChem (CID 786880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).