C23H25N3O3S — CID 7869068
(2S)-N-benzyl-2-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylpropanamide (PubChem CID 7869068) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7869068 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2S)-N-benzyl-2-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]quinazolin-2-yl]sulfanylpropanamide |
| SMILES | C[C@H](Sc1nc2ccccc2c(=O)n1C[C@H]1CCCO1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-16(21(27)24-14-17-8-3-2-4-9-17)30-23-25-20-12-6-5-11-19(20)22(28)26(23)15-18-10-7-13-29-18/h2-6,8-9,11-12,16,18H,7,10,13-15H2,1H3,(H,24,27)/t16-,18+/m0/s1 |
| InChIKey | YGQZXDODKBSUDE-FUHWJXTLSA-N |
| XLogP | 3.37 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |