C19H14ClF2N3OS — CID 7869616
2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,5-difluorophenyl)ethanone (PubChem CID 7869616) has the molecular formula C19H14ClF2N3OS and a molecular weight of 405.86 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 7869616 |
| Molecular Formula | C19H14ClF2N3OS |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-1-(2,5-difluorophenyl)ethanone |
| SMILES | C=CCn1c(SCC(=O)c2cc(F)ccc2F)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClF2N3OS/c1-2-9-25-18(12-3-5-13(20)6-4-12)23-24-19(25)27-11-17(26)15-10-14(21)7-8-16(15)22/h2-8,10H,1,9,11H2 |
| InChIKey | CFWJSLOUVJXFII-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|