C14H20N2O3 — CID 786985
3-methyl-4-nitro-N,N-dipropylbenzamide (PubChem CID 786985) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-methyl-4-nitro-N,N-dipropylbenzamide.
| Compound Name | 3-methyl-4-nitro-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 786985 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-methyl-4-nitro-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-8-15(9-5-2)14(17)12-6-7-13(16(18)19)11(3)10-12/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | DBKFJQQHSAZFFV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|