C16H15Cl2NOS — CID 7870527
(2S)-2-(2,5-dichlorophenyl)sulfanyl-N-(3-methylphenyl)propanamide (PubChem CID 7870527) has the molecular formula C16H15Cl2NOS and a molecular weight of 340.28 g/mol. Its IUPAC name is (2S)-2-(2,5-dichlorophenyl)sulfanyl-N-(3-methylphenyl)propanamide.
| Compound Name | (2S)-2-(2,5-dichlorophenyl)sulfanyl-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 7870527 |
| Molecular Formula | C16H15Cl2NOS |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | (2S)-2-(2,5-dichlorophenyl)sulfanyl-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)[C@H](C)Sc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NOS/c1-10-4-3-5-13(8-10)19-16(20)11(2)21-15-9-12(17)6-7-14(15)18/h3-9,11H,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | OYMBBZIQBVEPDV-NSHDSACASA-N |
| XLogP | 5.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |