C16H11ClF3N3O2S — CID 7870657
2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]ethyl benzoate (PubChem CID 7870657) has the molecular formula C16H11ClF3N3O2S and a molecular weight of 401.80 g/mol. Its IUPAC name is 2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]ethyl benzoate.
| Compound Name | 2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]ethyl benzoate |
|---|---|
| PubChem CID | 7870657 |
| Molecular Formula | C16H11ClF3N3O2S |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 2-[[8-chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]ethyl benzoate |
| SMILES | O=C(OCCSc1nnc2c(Cl)cc(C(F)(F)F)cn12)c1ccccc1 |
| InChI | InChI=1S/C16H11ClF3N3O2S/c17-12-8-11(16(18,19)20)9-23-13(12)21-22-15(23)26-7-6-25-14(24)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2 |
| InChIKey | IILJQMKHKPQZAG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|