C19H20N2O4 — CID 7871479
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7871479) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7871479 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] (3R)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc(N2C[C@H](C(=O)OCC(=O)c3ccc[nH]3)CC2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-2-13-5-7-15(8-6-13)21-11-14(10-18(21)23)19(24)25-12-17(22)16-4-3-9-20-16/h3-9,14,20H,2,10-12H2,1H3/t14-/m1/s1 |
| InChIKey | SPNQZZJLZSLCAA-CQSZACIVSA-N |
| XLogP | 2.36 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |