C17H13Cl2F2NO4 — CID 7872971
[2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 7872971) has the molecular formula C17H13Cl2F2NO4 and a molecular weight of 404.20 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 7872971 |
| Molecular Formula | C17H13Cl2F2NO4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H13Cl2F2NO4/c1-9(26-14-6-5-10(18)7-11(14)19)17(24)25-8-15(23)22-16-12(20)3-2-4-13(16)21/h2-7,9H,8H2,1H3,(H,22,23)/t9-/m1/s1 |
| InChIKey | DSDUOBOONRPFCF-SECBINFHSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |