About N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide
N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide (PubChem CID 787336) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide |
| PubChem CID | 787336 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide |
| SMILES | Cc1cc(C)nc(NC(=O)CC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19N3O/c1-8-6-9(2)14-11(13-8)15-10(16)7-12(3,4)5/h6H,7H2,1-5H3,(H,13,14,15,16) |
| InChIKey | CMQOKCMACWPSDL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide?
The IUPAC name of N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide (CID 787336) is N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide.
What is the SMILES notation for N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide?
The canonical SMILES for N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide is Cc1cc(C)nc(NC(=O)CC(C)(C)C)n1.
What is the InChIKey of N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide?
The InChIKey is CMQOKCMACWPSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-8-6-9(2)14-11(13-8)15-10(16)7-12(3,4)5/h6H,7H2,1-5H3,(H,13,14,15,16).
What are the key properties of N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide?
N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide has a molecular weight of 221.30 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dimethylpyrimidin-2-yl)-3,3-dimethylbutanamide is sourced from PubChem (CID 787336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).