C18H17NO5 — CID 7874733
[(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-phenylacetate (PubChem CID 7874733) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-phenylacetate.
| Compound Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 7874733 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [(2R)-1-(1,3-benzodioxol-5-ylamino)-1-oxopropan-2-yl] 2-phenylacetate |
| SMILES | C[C@@H](OC(=O)Cc1ccccc1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17NO5/c1-12(24-17(20)9-13-5-3-2-4-6-13)18(21)19-14-7-8-15-16(10-14)23-11-22-15/h2-8,10,12H,9,11H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | ZEQRCFBXTRGFOA-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |