About [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate
[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (PubChem CID 7875217) has the molecular formula C16H20BrNO4
and a molecular weight of 370.24 g/mol. Its IUPAC name is [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| PubChem CID | 7875217 |
| Molecular Formula | C16H20BrNO4 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)COC(=O)/C=C/c2ccc(Br)o2)C1 |
| InChI | InChI=1S/C16H20BrNO4/c1-11-7-12(2)9-18(8-11)15(19)10-21-16(20)6-4-13-3-5-14(17)22-13/h3-6,11-12H,7-10H2,1-2H3/b6-4+/t11-,12+ |
| InChIKey | LROUPQMMPNEACK-FVSXHXCTSA-N |
| XLogP | 3.10 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The IUPAC name of [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate (CID 7875217) is [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate.
What is the SMILES notation for [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The canonical SMILES for [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate is C[C@@H]1C[C@H](C)CN(C(=O)COC(=O)/C=C/c2ccc(Br)o2)C1.
What is the InChIKey of [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
The InChIKey is LROUPQMMPNEACK-FVSXHXCTSA-N. The full InChI is InChI=1S/C16H20BrNO4/c1-11-7-12(2)9-18(8-11)15(19)10-21-16(20)6-4-13-3-5-14(17)22-13/h3-6,11-12H,7-10H2,1-2H3/b6-4+/t11-,12+.
What are the key properties of [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate?
[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate has a molecular weight of 370.24 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] (E)-3-(5-bromofuran-2-yl)prop-2-enoate is sourced from PubChem (CID 7875217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).