C11H17F3N4O2S — CID 78759418
2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 78759418) has the molecular formula C11H17F3N4O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 78759418 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | COCCCn1cnnc1SC(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N4O2S/c1-8(9(19)15-6-11(12,13)14)21-10-17-16-7-18(10)4-3-5-20-2/h7-8H,3-6H2,1-2H3,(H,15,19) |
| InChIKey | JEIAIWAGUJXPMI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|