C15H18ClN3O3S — CID 78759730
3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole (PubChem CID 78759730) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole.
| Compound Name | 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 78759730 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-(3-methoxypropyl)-1,2,4-triazole |
| SMILES | COCCCn1cnnc1SCc1cc(Cl)cc2c1OCOC2 |
| InChI | InChI=1S/C15H18ClN3O3S/c1-20-4-2-3-19-9-17-18-15(19)23-8-12-6-13(16)5-11-7-21-10-22-14(11)12/h5-6,9H,2-4,7-8,10H2,1H3 |
| InChIKey | OCRKQLZFGZYGNR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|