C16H25NO4 — CID 78760333
2-(3,4-dimethylphenoxy)-N,N-bis(2-methoxyethyl)acetamide (PubChem CID 78760333) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N,N-bis(2-methoxyethyl)acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N,N-bis(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 78760333 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N,N-bis(2-methoxyethyl)acetamide |
| SMILES | COCCN(CCOC)C(=O)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H25NO4/c1-13-5-6-15(11-14(13)2)21-12-16(18)17(7-9-19-3)8-10-20-4/h5-6,11H,7-10,12H2,1-4H3 |
| InChIKey | BERIZENCASEWMC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |