C11H9Cl2F3N4OS — CID 78761366
3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine (PubChem CID 78761366) has the molecular formula C11H9Cl2F3N4OS and a molecular weight of 373.19 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 78761366 |
| Molecular Formula | C11H9Cl2F3N4OS |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCOc2ccc(Cl)cc2Cl)nnc1C(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F3N4OS/c12-6-1-2-8(7(13)5-6)21-3-4-22-10-19-18-9(20(10)17)11(14,15)16/h1-2,5H,3-4,17H2 |
| InChIKey | VIXSNKHZNLUITM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|