About N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide
N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide (PubChem CID 787615) has the molecular formula C11H15N3O3S
and a molecular weight of 269.33 g/mol. Its IUPAC name is N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide |
| PubChem CID | 787615 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H15N3O3S/c1-3-14(4-2)18(16,17)8-5-6-9-10(7-8)13-11(15)12-9/h5-7H,3-4H2,1-2H3,(H2,12,13,15) |
| InChIKey | KUSAFIHTRLXIST-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide?
The IUPAC name of N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide (CID 787615) is N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide.
What is the SMILES notation for N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide?
The canonical SMILES for N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide is CCN(CC)S(=O)(=O)c1ccc2[nH]c(=O)[nH]c2c1.
What is the InChIKey of N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide?
The InChIKey is KUSAFIHTRLXIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c1-3-14(4-2)18(16,17)8-5-6-9-10(7-8)13-11(15)12-9/h5-7H,3-4H2,1-2H3,(H2,12,13,15).
What are the key properties of N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide?
N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide has a molecular weight of 269.33 g/mol, XLogP of 0.89, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-oxo-1,3-dihydrobenzimidazole-5-sulfonamide is sourced from PubChem (CID 787615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).