C17H21N3O2S — CID 78761722
3-(4-methoxyphenyl)-4-(oxolan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole (PubChem CID 78761722) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-(oxolan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(4-methoxyphenyl)-4-(oxolan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 78761722 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-(oxolan-2-ylmethyl)-5-prop-2-enylsulfanyl-1,2,4-triazole |
| SMILES | C=CCSc1nnc(-c2ccc(OC)cc2)n1CC1CCCO1 |
| InChI | InChI=1S/C17H21N3O2S/c1-3-11-23-17-19-18-16(13-6-8-14(21-2)9-7-13)20(17)12-15-5-4-10-22-15/h3,6-9,15H,1,4-5,10-12H2,2H3 |
| InChIKey | ONDSDAWKHNXGLY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|