C17H17N5O2S — CID 78764597
2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide (PubChem CID 78764597) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 78764597 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nnc(-c2cccnc2)n1Cc1ccco1 |
| InChI | InChI=1S/C17H17N5O2S/c1-2-7-19-15(23)12-25-17-21-20-16(13-5-3-8-18-10-13)22(17)11-14-6-4-9-24-14/h2-6,8-10H,1,7,11-12H2,(H,19,23) |
| InChIKey | SJBCYIWHDNJFES-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|