C12H15N3S — CID 78765150
4-(2,4-dimethylphenyl)-3-ethylsulfanyl-1,2,4-triazole (PubChem CID 78765150) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-3-ethylsulfanyl-1,2,4-triazole.
| Compound Name | 4-(2,4-dimethylphenyl)-3-ethylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 78765150 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-3-ethylsulfanyl-1,2,4-triazole |
| SMILES | CCSc1nncn1-c1ccc(C)cc1C |
| InChI | InChI=1S/C12H15N3S/c1-4-16-12-14-13-8-15(12)11-6-5-9(2)7-10(11)3/h5-8H,4H2,1-3H3 |
| InChIKey | QOKGENPZYZJBFT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |