C18H27NO3 — CID 78765430
2-(3-acetylphenoxy)-N,N-bis(2-methylpropyl)acetamide (PubChem CID 78765430) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-(3-acetylphenoxy)-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 78765430 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-(3-acetylphenoxy)-N,N-bis(2-methylpropyl)acetamide |
| SMILES | CC(=O)c1cccc(OCC(=O)N(CC(C)C)CC(C)C)c1 |
| InChI | InChI=1S/C18H27NO3/c1-13(2)10-19(11-14(3)4)18(21)12-22-17-8-6-7-16(9-17)15(5)20/h6-9,13-14H,10-12H2,1-5H3 |
| InChIKey | PJAZLBBAMAJGJS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |