C15H18N2O5 — CID 78765507
2-(4-methoxy-2-nitrophenoxy)-N,N-bis(prop-2-enyl)acetamide (PubChem CID 78765507) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-(4-methoxy-2-nitrophenoxy)-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(4-methoxy-2-nitrophenoxy)-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 78765507 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(4-methoxy-2-nitrophenoxy)-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)COc1ccc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O5/c1-4-8-16(9-5-2)15(18)11-22-14-7-6-12(21-3)10-13(14)17(19)20/h4-7,10H,1-2,8-9,11H2,3H3 |
| InChIKey | TZZYVGTTYGGMQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|