About (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate
(5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate (PubChem CID 78765791) has the molecular formula C9H13N3OS2
and a molecular weight of 243.36 g/mol. Its IUPAC name is (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate.
Molecular Properties
| Compound Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate |
| PubChem CID | 78765791 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate |
| SMILES | Cc1nnc(CSC(=S)N2CCCC2)o1 |
| InChI | InChI=1S/C9H13N3OS2/c1-7-10-11-8(13-7)6-15-9(14)12-4-2-3-5-12/h2-6H2,1H3 |
| InChIKey | JNNPORRWYGRXHN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate?
The IUPAC name of (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate (CID 78765791) is (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate.
What is the SMILES notation for (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate?
The canonical SMILES for (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate is Cc1nnc(CSC(=S)N2CCCC2)o1.
What is the InChIKey of (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate?
The InChIKey is JNNPORRWYGRXHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS2/c1-7-10-11-8(13-7)6-15-9(14)12-4-2-3-5-12/h2-6H2,1H3.
What are the key properties of (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate?
(5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate has a molecular weight of 243.36 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3,4-oxadiazol-2-yl)methyl pyrrolidine-1-carbodithioate is sourced from PubChem (CID 78765791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).