C13H20N2O2S — CID 78767027
N,N-di(propan-2-yl)-2-(thiophen-2-ylmethylideneamino)oxyacetamide (PubChem CID 78767027) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-2-(thiophen-2-ylmethylideneamino)oxyacetamide.
| Compound Name | N,N-di(propan-2-yl)-2-(thiophen-2-ylmethylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 78767027 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N,N-di(propan-2-yl)-2-(thiophen-2-ylmethylideneamino)oxyacetamide |
| SMILES | CC(C)N(C(=O)CON=Cc1cccs1)C(C)C |
| InChI | InChI=1S/C13H20N2O2S/c1-10(2)15(11(3)4)13(16)9-17-14-8-12-6-5-7-18-12/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | SEBNGPFFTYNGNM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|