C18H27NO3 — CID 78767495
N-(4-hydroxycyclohexyl)-2-(5-methyl-2-propan-2-ylphenoxy)acetamide (PubChem CID 78767495) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-2-(5-methyl-2-propan-2-ylphenoxy)acetamide.
| Compound Name | N-(4-hydroxycyclohexyl)-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
|---|---|
| PubChem CID | 78767495 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-2-(5-methyl-2-propan-2-ylphenoxy)acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NC2CCC(O)CC2)c1 |
| InChI | InChI=1S/C18H27NO3/c1-12(2)16-9-4-13(3)10-17(16)22-11-18(21)19-14-5-7-15(20)8-6-14/h4,9-10,12,14-15,20H,5-8,11H2,1-3H3,(H,19,21) |
| InChIKey | LEYXNWOPDOISEN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |