C19H28N2O4S — CID 78767659
N-(4-hydroxycyclohexyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 78767659) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-hydroxycyclohexyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 78767659 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1cccc(C(=O)NC2CCC(O)CC2)c1 |
| InChI | InChI=1S/C19H28N2O4S/c1-14-5-2-3-12-21(14)26(24,25)18-7-4-6-15(13-18)19(23)20-16-8-10-17(22)11-9-16/h4,6-7,13-14,16-17,22H,2-3,5,8-12H2,1H3,(H,20,23) |
| InChIKey | VOCPTUHCSMWGBG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |