C18H23NO4 — CID 78768450
3,4-diethoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 78768450) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3,4-diethoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 3,4-diethoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 78768450 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3,4-diethoxy-N-methyl-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)N(C)Cc2ccc(C)o2)cc1OCC |
| InChI | InChI=1S/C18H23NO4/c1-5-21-16-10-8-14(11-17(16)22-6-2)18(20)19(4)12-15-9-7-13(3)23-15/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | JYOWJVPAWPPCAV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |