C15H12F3NO — CID 78769060
3,5-difluoro-N-[(2-fluorophenyl)methyl]-N-methylbenzamide (PubChem CID 78769060) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is 3,5-difluoro-N-[(2-fluorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 3,5-difluoro-N-[(2-fluorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 78769060 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3,5-difluoro-N-[(2-fluorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1F)C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H12F3NO/c1-19(9-10-4-2-3-5-14(10)18)15(20)11-6-12(16)8-13(17)7-11/h2-8H,9H2,1H3 |
| InChIKey | SHBZPJVARFGTJM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |