About oxan-2-ylmethyl 2-(4-bromophenoxy)acetate
oxan-2-ylmethyl 2-(4-bromophenoxy)acetate (PubChem CID 78769379) has the molecular formula C14H17BrO4
and a molecular weight of 329.19 g/mol. Its IUPAC name is oxan-2-ylmethyl 2-(4-bromophenoxy)acetate.
Molecular Properties
| Compound Name | oxan-2-ylmethyl 2-(4-bromophenoxy)acetate |
| PubChem CID | 78769379 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | oxan-2-ylmethyl 2-(4-bromophenoxy)acetate |
| SMILES | O=C(COc1ccc(Br)cc1)OCC1CCCCO1 |
| InChI | InChI=1S/C14H17BrO4/c15-11-4-6-12(7-5-11)18-10-14(16)19-9-13-3-1-2-8-17-13/h4-7,13H,1-3,8-10H2 |
| InChIKey | SRMFVBSMPDNFDX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxan-2-ylmethyl 2-(4-bromophenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxan-2-ylmethyl 2-(4-bromophenoxy)acetate?
The IUPAC name of oxan-2-ylmethyl 2-(4-bromophenoxy)acetate (CID 78769379) is oxan-2-ylmethyl 2-(4-bromophenoxy)acetate.
What is the SMILES notation for oxan-2-ylmethyl 2-(4-bromophenoxy)acetate?
The canonical SMILES for oxan-2-ylmethyl 2-(4-bromophenoxy)acetate is O=C(COc1ccc(Br)cc1)OCC1CCCCO1.
What is the InChIKey of oxan-2-ylmethyl 2-(4-bromophenoxy)acetate?
The InChIKey is SRMFVBSMPDNFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrO4/c15-11-4-6-12(7-5-11)18-10-14(16)19-9-13-3-1-2-8-17-13/h4-7,13H,1-3,8-10H2.
What are the key properties of oxan-2-ylmethyl 2-(4-bromophenoxy)acetate?
oxan-2-ylmethyl 2-(4-bromophenoxy)acetate has a molecular weight of 329.19 g/mol, XLogP of 2.94, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxan-2-ylmethyl 2-(4-bromophenoxy)acetate is sourced from PubChem (CID 78769379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).