C20H23N5OS2 — CID 7876981
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide (PubChem CID 7876981) has the molecular formula C20H23N5OS2 and a molecular weight of 413.57 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 7876981 |
| Molecular Formula | C20H23N5OS2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)CSc3nnc4n3CCCCC4)n2)cc1 |
| InChI | InChI=1S/C20H23N5OS2/c1-2-14-7-9-15(10-8-14)16-12-27-19(21-16)22-18(26)13-28-20-24-23-17-6-4-3-5-11-25(17)20/h7-10,12H,2-6,11,13H2,1H3,(H,21,22,26) |
| InChIKey | AWQKAXPTJAGUOZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |