C17H22N2O4 — CID 78771684
methyl 2-[2-(4-cyanophenoxy)propanoylamino]-3-methylpentanoate (PubChem CID 78771684) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl 2-[2-(4-cyanophenoxy)propanoylamino]-3-methylpentanoate.
| Compound Name | methyl 2-[2-(4-cyanophenoxy)propanoylamino]-3-methylpentanoate |
|---|---|
| PubChem CID | 78771684 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl 2-[2-(4-cyanophenoxy)propanoylamino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)C(C)Oc1ccc(C#N)cc1)C(=O)OC |
| InChI | InChI=1S/C17H22N2O4/c1-5-11(2)15(17(21)22-4)19-16(20)12(3)23-14-8-6-13(10-18)7-9-14/h6-9,11-12,15H,5H2,1-4H3,(H,19,20) |
| InChIKey | CKZMHRSZBGIWAX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |