C20H24N2O3S — CID 78772213
3-pyridin-4-ylpropyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 78772213) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | 3-pyridin-4-ylpropyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 78772213 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-pyridin-4-ylpropyl 2-[2-(4-methylanilino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | Cc1ccc(NC(=O)CSC(C)C(=O)OCCCc2ccncc2)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15-5-7-18(8-6-15)22-19(23)14-26-16(2)20(24)25-13-3-4-17-9-11-21-12-10-17/h5-12,16H,3-4,13-14H2,1-2H3,(H,22,23) |
| InChIKey | QNNTWBKGGPJCEB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|