C20H27N5OS2 — CID 7877331
6-methyl-5-[(2R)-2-methylbutyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 7877331) has the molecular formula C20H27N5OS2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 6-methyl-5-[(2R)-2-methylbutyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-methyl-5-[(2R)-2-methylbutyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7877331 |
| Molecular Formula | C20H27N5OS2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 6-methyl-5-[(2R)-2-methylbutyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC[C@@H](C)Cc1c(C)sc2nc(CSc3nnc4n3CCCCC4)[nH]c(=O)c12 |
| InChI | InChI=1S/C20H27N5OS2/c1-4-12(2)10-14-13(3)28-19-17(14)18(26)21-15(22-19)11-27-20-24-23-16-8-6-5-7-9-25(16)20/h12H,4-11H2,1-3H3,(H,21,22,26)/t12-/m1/s1 |
| InChIKey | BMZXEOCPTZOJEM-GFCCVEGCSA-N |
| XLogP | 4.49 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |