C14H22N4O2S — CID 7877477
N-[[(2S)-oxolan-2-yl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide (PubChem CID 7877477) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 7877477 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nnc2n1CCCCC2)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C14H22N4O2S/c19-13(15-9-11-5-4-8-20-11)10-21-14-17-16-12-6-2-1-3-7-18(12)14/h11H,1-10H2,(H,15,19)/t11-/m0/s1 |
| InChIKey | JTSYKSPQEBUTCW-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |