C17H17N3O3S2 — CID 78777322
(2-methoxyphenyl) 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 78777322) has the molecular formula C17H17N3O3S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | (2-methoxyphenyl) 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 78777322 |
| Molecular Formula | C17H17N3O3S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | (2-methoxyphenyl) 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | CCn1c(SCC(=O)Oc2ccccc2OC)nnc1-c1cccs1 |
| InChI | InChI=1S/C17H17N3O3S2/c1-3-20-16(14-9-6-10-24-14)18-19-17(20)25-11-15(21)23-13-8-5-4-7-12(13)22-2/h4-10H,3,11H2,1-2H3 |
| InChIKey | QUTAFLRYQCPTIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|