C17H18N4OS2 — CID 7877758
4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-thiophen-2-ylbutan-1-one (PubChem CID 7877758) has the molecular formula C17H18N4OS2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 7877758 |
| Molecular Formula | C17H18N4OS2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-thiophen-2-ylbutan-1-one |
| SMILES | Cc1ccc(C)c(-n2nnnc2SCCCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H18N4OS2/c1-12-7-8-13(2)14(11-12)21-17(18-19-20-21)24-10-3-5-15(22)16-6-4-9-23-16/h4,6-9,11H,3,5,10H2,1-2H3 |
| InChIKey | NMYGVLPQEFZYDA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|