C15H16N6OS — CID 7877812
(2R)-4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-oxobutanenitrile (PubChem CID 7877812) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is (2R)-4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-oxobutanenitrile.
| Compound Name | (2R)-4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 7877812 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (2R)-4-[1-(2,5-dimethylphenyl)tetrazol-5-yl]sulfanyl-2-ethanimidoyl-3-oxobutanenitrile |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)CSc1nnnn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C15H16N6OS/c1-9-4-5-10(2)13(6-9)21-15(18-19-20-21)23-8-14(22)12(7-16)11(3)17/h4-6,12,17H,8H2,1-3H3/b17-11+/t12-/m0/s1 |
| InChIKey | ZXPONCIUCSACDU-OOIIIRTPSA-N |
| XLogP | 2.12 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|