C19H28N4O3S — CID 78778551
N-(2-butan-2-ylpyrazol-3-yl)-5-(diethylsulfamoyl)-2-methylbenzamide (PubChem CID 78778551) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-(2-butan-2-ylpyrazol-3-yl)-5-(diethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-(2-butan-2-ylpyrazol-3-yl)-5-(diethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 78778551 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-(2-butan-2-ylpyrazol-3-yl)-5-(diethylsulfamoyl)-2-methylbenzamide |
| SMILES | CCC(C)n1nccc1NC(=O)c1cc(S(=O)(=O)N(CC)CC)ccc1C |
| InChI | InChI=1S/C19H28N4O3S/c1-6-15(5)23-18(11-12-20-23)21-19(24)17-13-16(10-9-14(17)4)27(25,26)22(7-2)8-3/h9-13,15H,6-8H2,1-5H3,(H,21,24) |
| InChIKey | GIMVKJVSKPTUAB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |