C18H16ClFN2O4 — CID 7877892
[(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-[(4-fluorobenzoyl)amino]acetate (PubChem CID 7877892) has the molecular formula C18H16ClFN2O4 and a molecular weight of 378.79 g/mol. Its IUPAC name is [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-[(4-fluorobenzoyl)amino]acetate.
| Compound Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-[(4-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7877892 |
| Molecular Formula | C18H16ClFN2O4 |
| Molecular Weight | 378.79 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | [(2R)-1-(4-chloroanilino)-1-oxopropan-2-yl] 2-[(4-fluorobenzoyl)amino]acetate |
| SMILES | C[C@@H](OC(=O)CNC(=O)c1ccc(F)cc1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClFN2O4/c1-11(17(24)22-15-8-4-13(19)5-9-15)26-16(23)10-21-18(25)12-2-6-14(20)7-3-12/h2-9,11H,10H2,1H3,(H,21,25)(H,22,24)/t11-/m1/s1 |
| InChIKey | CKGXYRCPZOJXNU-LLVKDONJSA-N |
| XLogP | 2.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |