C19H16N2O4 — CID 78779187
(4-acetamidophenyl) (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate (PubChem CID 78779187) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (4-acetamidophenyl) (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate.
| Compound Name | (4-acetamidophenyl) (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 78779187 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (4-acetamidophenyl) (E)-3-[4-(cyanomethoxy)phenyl]prop-2-enoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)/C=C/c2ccc(OCC#N)cc2)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-14(22)21-16-5-9-18(10-6-16)25-19(23)11-4-15-2-7-17(8-3-15)24-13-12-20/h2-11H,13H2,1H3,(H,21,22)/b11-4+ |
| InChIKey | RCCIXGYIEXNJRP-NYYWCZLTSA-N |
| XLogP | 3.17 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|