C20H21N3O5S — CID 78780076
1-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 78780076) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is 1-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 78780076 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 1-[4-(2-methyl-5-nitrophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCN(C(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21N3O5S/c1-16-7-9-18(23(25)26)15-19(16)29(27,28)22-13-11-21(12-14-22)20(24)10-8-17-5-3-2-4-6-17/h2-10,15H,11-14H2,1H3 |
| InChIKey | VQAJGKDLHWZDSN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|