About (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone
(2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (PubChem CID 78780639) has the molecular formula C15H11F2NOS
and a molecular weight of 291.32 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
Molecular Properties
| Compound Name | (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| PubChem CID | 78780639 |
| Molecular Formula | C15H11F2NOS |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCSc2ccccc21 |
| InChI | InChI=1S/C15H11F2NOS/c16-10-4-3-5-11(17)14(10)15(19)18-8-9-20-13-7-2-1-6-12(13)18/h1-7H,8-9H2 |
| InChIKey | BCXLQBGKISZFBE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone?
The IUPAC name of (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone (CID 78780639) is (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone.
What is the SMILES notation for (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone?
The canonical SMILES for (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone is O=C(c1c(F)cccc1F)N1CCSc2ccccc21.
What is the InChIKey of (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone?
The InChIKey is BCXLQBGKISZFBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F2NOS/c16-10-4-3-5-11(17)14(10)15(19)18-8-9-20-13-7-2-1-6-12(13)18/h1-7H,8-9H2.
What are the key properties of (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone?
(2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone has a molecular weight of 291.32 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)-(2,3-dihydro-1,4-benzothiazin-4-yl)methanone is sourced from PubChem (CID 78780639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).