About 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione
1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione (PubChem CID 78782624) has the molecular formula C16H23NO2S
and a molecular weight of 293.43 g/mol. Its IUPAC name is 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione.
Molecular Properties
| Compound Name | 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione |
| PubChem CID | 78782624 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione |
| SMILES | Cc1cc(C(=O)CCC(=O)N2CCCCCC2)c(C)s1 |
| InChI | InChI=1S/C16H23NO2S/c1-12-11-14(13(2)20-12)15(18)7-8-16(19)17-9-5-3-4-6-10-17/h11H,3-10H2,1-2H3 |
| InChIKey | VSODDMQOIYWGCO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione?
The IUPAC name of 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione (CID 78782624) is 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione.
What is the SMILES notation for 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione?
The canonical SMILES for 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione is Cc1cc(C(=O)CCC(=O)N2CCCCCC2)c(C)s1.
What is the InChIKey of 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione?
The InChIKey is VSODDMQOIYWGCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2S/c1-12-11-14(13(2)20-12)15(18)7-8-16(19)17-9-5-3-4-6-10-17/h11H,3-10H2,1-2H3.
What are the key properties of 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione?
1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione has a molecular weight of 293.43 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azepan-1-yl)-4-(2,5-dimethylthiophen-3-yl)butane-1,4-dione is sourced from PubChem (CID 78782624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).