About 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide
1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide (PubChem CID 78786042) has the molecular formula C11H14F3N3O2
and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide |
| PubChem CID | 78786042 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NCC(F)(F)F)ccc1=O |
| InChI | InChI=1S/C11H14F3N3O2/c1-2-3-6-17-9(18)5-4-8(16-17)10(19)15-7-11(12,13)14/h4-5H,2-3,6-7H2,1H3,(H,15,19) |
| InChIKey | IOVOOLPYGYPRMR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide?
The IUPAC name of 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide (CID 78786042) is 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide.
What is the SMILES notation for 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide?
The canonical SMILES for 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide is CCCCn1nc(C(=O)NCC(F)(F)F)ccc1=O.
What is the InChIKey of 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide?
The InChIKey is IOVOOLPYGYPRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O2/c1-2-3-6-17-9(18)5-4-8(16-17)10(19)15-7-11(12,13)14/h4-5H,2-3,6-7H2,1H3,(H,15,19).
What are the key properties of 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide?
1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide has a molecular weight of 277.25 g/mol, XLogP of 1.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-6-oxo-N-(2,2,2-trifluoroethyl)pyridazine-3-carboxamide is sourced from PubChem (CID 78786042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).