C14H12F3NO3S — CID 78786685
methyl 2-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylate (PubChem CID 78786685) has the molecular formula C14H12F3NO3S and a molecular weight of 331.32 g/mol. Its IUPAC name is methyl 2-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylate.
| Compound Name | methyl 2-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 78786685 |
| Molecular Formula | C14H12F3NO3S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | methyl 2-methyl-5-[[5-(trifluoromethyl)-2-pyridinyl]sulfanylmethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1cc(CSc2ccc(C(F)(F)F)cn2)oc1C |
| InChI | InChI=1S/C14H12F3NO3S/c1-8-11(13(19)20-2)5-10(21-8)7-22-12-4-3-9(6-18-12)14(15,16)17/h3-6H,7H2,1-2H3 |
| InChIKey | MRERSIPKGCPOKY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |